About 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde
5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde (PubChem CID 96624372) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde |
| PubChem CID | 96624372 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde |
| SMILES | Cc1cc(Cc2oncc2C=O)no1 |
| InChI | InChI=1S/C9H8N2O3/c1-6-2-8(11-13-6)3-9-7(5-12)4-10-14-9/h2,4-5H,3H2,1H3 |
| InChIKey | FMTNOGXYOSLCIL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde?
The IUPAC name of 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde (CID 96624372) is 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde.
What is the SMILES notation for 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde?
The canonical SMILES for 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde is Cc1cc(Cc2oncc2C=O)no1.
What is the InChIKey of 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde?
The InChIKey is FMTNOGXYOSLCIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c1-6-2-8(11-13-6)3-9-7(5-12)4-10-14-9/h2,4-5H,3H2,1H3.
What are the key properties of 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde?
5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde has a molecular weight of 192.17 g/mol, XLogP of 1.37, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,2-oxazole-4-carbaldehyde is sourced from PubChem (CID 96624372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).