About 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde
5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde (PubChem CID 96624767) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde |
| PubChem CID | 96624767 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde |
| SMILES | Cc1nocc1Cc1[nH]ncc1C=O |
| InChI | InChI=1S/C9H9N3O2/c1-6-7(5-14-12-6)2-9-8(4-13)3-10-11-9/h3-5H,2H2,1H3,(H,10,11) |
| InChIKey | ARJSZQGDJPZFDQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde?
The IUPAC name of 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde (CID 96624767) is 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde.
What is the SMILES notation for 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde?
The canonical SMILES for 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde is Cc1nocc1Cc1[nH]ncc1C=O.
What is the InChIKey of 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde?
The InChIKey is ARJSZQGDJPZFDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-6-7(5-14-12-6)2-9-8(4-13)3-10-11-9/h3-5H,2H2,1H3,(H,10,11).
What are the key properties of 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde?
5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde has a molecular weight of 191.19 g/mol, XLogP of 1.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-methyl-1,2-oxazol-4-yl)methyl]-1H-pyrazole-4-carbaldehyde is sourced from PubChem (CID 96624767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).