C7H7ClN4 — CID 96627648
2-(chloromethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 96627648) has the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. Its IUPAC name is 2-(chloromethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-(chloromethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 96627648 |
| Molecular Formula | C7H7ClN4 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 2-(chloromethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1nc(CCl)nn2cccc12 |
| InChI | InChI=1S/C7H7ClN4/c8-4-6-10-7(9)5-2-1-3-12(5)11-6/h1-3H,4H2,(H2,9,10,11) |
| InChIKey | BRLAKSPBRIFARA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|