C11H22N2 — CID 96627763
(1S,7R)-2-methyl-2,11-diazabicyclo[5.5.0]dodecane (PubChem CID 96627763) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (1S,7R)-2-methyl-2,11-diazabicyclo[5.5.0]dodecane.
| Compound Name | (1S,7R)-2-methyl-2,11-diazabicyclo[5.5.0]dodecane |
|---|---|
| PubChem CID | 96627763 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (1S,7R)-2-methyl-2,11-diazabicyclo[5.5.0]dodecane |
| SMILES | CN1CCCC[C@@H]2CCCNC[C@H]21 |
| InChI | InChI=1S/C11H22N2/c1-13-8-3-2-5-10-6-4-7-12-9-11(10)13/h10-12H,2-9H2,1H3/t10-,11-/m1/s1 |
| InChIKey | NXKCTBSKIYFXGN-GHMZBOCLSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |