(6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid

C9H12N2O2 — CID 96628928

IUPAC(6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid
SMILESCn1ncc2c1C[C@H](C(=O)O)CC2
InChIInChI=1S/C9H12N2O2/c1-11-8-4-6(9(12)13)2-3-7(8)5-10-11/h5-6H,2-4H2,1H3,(H,12,13)/t6-/m1/s1
InChIKeyQJYIDHFECIZGMM-ZCFIWIBFSA-N
MW180.21 g/mol
LogP0.61
Rot. Bonds1

About (6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid

(6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid (PubChem CID 96628928) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid.

Molecular Properties

Compound Name(6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid
PubChem CID96628928
Molecular FormulaC9H12N2O2
Molecular Weight180.21 g/mol
Exact Mass180.09
IUPAC Name(6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid
SMILESCn1ncc2c1C[C@H](C(=O)O)CC2
InChIInChI=1S/C9H12N2O2/c1-11-8-4-6(9(12)13)2-3-7(8)5-10-11/h5-6H,2-4H2,1H3,(H,12,13)/t6-/m1/s1
InChIKeyQJYIDHFECIZGMM-ZCFIWIBFSA-N
XLogP0.61
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.21
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid?
The IUPAC name of (6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid (CID 96628928) is (6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid.
What is the SMILES notation for (6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid?
The canonical SMILES for (6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid is Cn1ncc2c1C[C@H](C(=O)O)CC2.
What is the InChIKey of (6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid?
The InChIKey is QJYIDHFECIZGMM-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-11-8-4-6(9(12)13)2-3-7(8)5-10-11/h5-6H,2-4H2,1H3,(H,12,13)/t6-/m1/s1.
What are the key properties of (6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid?
(6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid has a molecular weight of 180.21 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carboxylic acid is sourced from PubChem (CID 96628928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).