5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid

C7H4N2O4 — CID 96629000

IUPAC5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid
SMILESO=C(O)c1cnoc1-c1ccon1
InChIInChI=1S/C7H4N2O4/c10-7(11)4-3-8-13-6(4)5-1-2-12-9-5/h1-3H,(H,10,11)
InChIKeyJJVQWCHPEDJTFD-UHFFFAOYSA-N
MW180.12 g/mol
LogP1.03
Rot. Bonds2

About 5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid

5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid (PubChem CID 96629000) has the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. Its IUPAC name is 5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid
PubChem CID96629000
Molecular FormulaC7H4N2O4
Molecular Weight180.12 g/mol
Exact Mass180.02
IUPAC Name5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid
SMILESO=C(O)c1cnoc1-c1ccon1
InChIInChI=1S/C7H4N2O4/c10-7(11)4-3-8-13-6(4)5-1-2-12-9-5/h1-3H,(H,10,11)
InChIKeyJJVQWCHPEDJTFD-UHFFFAOYSA-N
XLogP1.03
TPSA89.36 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.12
LogP ≤ 51.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid (CID 96629000) is 5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid is O=C(O)c1cnoc1-c1ccon1.
What is the InChIKey of 5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid?
The InChIKey is JJVQWCHPEDJTFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O4/c10-7(11)4-3-8-13-6(4)5-1-2-12-9-5/h1-3H,(H,10,11).
What are the key properties of 5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid?
5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid has a molecular weight of 180.12 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-oxazol-3-yl)-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 96629000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).