About 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one
8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one (PubChem CID 96629179) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one.
Molecular Properties
| Compound Name | 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one |
| PubChem CID | 96629179 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one |
| SMILES | CN1CCn2c1c(CN)ccc2=O |
| InChI | InChI=1S/C9H13N3O/c1-11-4-5-12-8(13)3-2-7(6-10)9(11)12/h2-3H,4-6,10H2,1H3 |
| InChIKey | WLYWUKBWEOEDGY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one?
The IUPAC name of 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one (CID 96629179) is 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one.
What is the SMILES notation for 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one?
The canonical SMILES for 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one is CN1CCn2c1c(CN)ccc2=O.
What is the InChIKey of 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one?
The InChIKey is WLYWUKBWEOEDGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c1-11-4-5-12-8(13)3-2-7(6-10)9(11)12/h2-3H,4-6,10H2,1H3.
What are the key properties of 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one?
8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one has a molecular weight of 179.22 g/mol, XLogP of -0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(aminomethyl)-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one is sourced from PubChem (CID 96629179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).