About (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol
(1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol (PubChem CID 96629920) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol.
Molecular Properties
| Compound Name | (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol |
| PubChem CID | 96629920 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol |
| SMILES | NC[C@@H](O)c1cnc2ccccn12 |
| InChI | InChI=1S/C9H11N3O/c10-5-8(13)7-6-11-9-3-1-2-4-12(7)9/h1-4,6,8,13H,5,10H2/t8-/m1/s1 |
| InChIKey | GLOYCSHMWYVMFS-MRVPVSSYSA-N |
| XLogP | 0.33 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol?
The IUPAC name of (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol (CID 96629920) is (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol.
What is the SMILES notation for (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol?
The canonical SMILES for (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol is NC[C@@H](O)c1cnc2ccccn12.
What is the InChIKey of (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol?
The InChIKey is GLOYCSHMWYVMFS-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H11N3O/c10-5-8(13)7-6-11-9-3-1-2-4-12(7)9/h1-4,6,8,13H,5,10H2/t8-/m1/s1.
What are the key properties of (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol?
(1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol has a molecular weight of 177.21 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-amino-1-imidazo[1,2-a]pyridin-3-ylethanol is sourced from PubChem (CID 96629920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).