C9H9N3O — CID 96630318
6-(5-methyl-1,2-oxazol-3-yl)pyridin-3-amine (PubChem CID 96630318) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 6-(5-methyl-1,2-oxazol-3-yl)pyridin-3-amine.
| Compound Name | 6-(5-methyl-1,2-oxazol-3-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 96630318 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 6-(5-methyl-1,2-oxazol-3-yl)pyridin-3-amine |
| SMILES | Cc1cc(-c2ccc(N)cn2)no1 |
| InChI | InChI=1S/C9H9N3O/c1-6-4-9(12-13-6)8-3-2-7(10)5-11-8/h2-5H,10H2,1H3 |
| InChIKey | ICIGAUCCEWOCJQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |