C9H10N4 — CID 96630461
8-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene (PubChem CID 96630461) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 8-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene.
| Compound Name | 8-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 96630461 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 8-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene |
| SMILES | Cc1nc2[nH]ncc2c2c1CNC2 |
| InChI | InChI=1S/C9H10N4/c1-5-6-2-10-3-7(6)8-4-11-13-9(8)12-5/h4,10H,2-3H2,1H3,(H,11,12,13) |
| InChIKey | IQTBPCFPLQHGNH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |