About 5-(diethylamino)-1,2-oxazole-3-carbaldehyde
5-(diethylamino)-1,2-oxazole-3-carbaldehyde (PubChem CID 96632493) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-(diethylamino)-1,2-oxazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-(diethylamino)-1,2-oxazole-3-carbaldehyde |
| PubChem CID | 96632493 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 5-(diethylamino)-1,2-oxazole-3-carbaldehyde |
| SMILES | CCN(CC)c1cc(C=O)no1 |
| InChI | InChI=1S/C8H12N2O2/c1-3-10(4-2)8-5-7(6-11)9-12-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | QKBMAKDWKZNZAS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(diethylamino)-1,2-oxazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diethylamino)-1,2-oxazole-3-carbaldehyde?
The IUPAC name of 5-(diethylamino)-1,2-oxazole-3-carbaldehyde (CID 96632493) is 5-(diethylamino)-1,2-oxazole-3-carbaldehyde.
What is the SMILES notation for 5-(diethylamino)-1,2-oxazole-3-carbaldehyde?
The canonical SMILES for 5-(diethylamino)-1,2-oxazole-3-carbaldehyde is CCN(CC)c1cc(C=O)no1.
What is the InChIKey of 5-(diethylamino)-1,2-oxazole-3-carbaldehyde?
The InChIKey is QKBMAKDWKZNZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-3-10(4-2)8-5-7(6-11)9-12-8/h5-6H,3-4H2,1-2H3.
What are the key properties of 5-(diethylamino)-1,2-oxazole-3-carbaldehyde?
5-(diethylamino)-1,2-oxazole-3-carbaldehyde has a molecular weight of 168.20 g/mol, XLogP of 1.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diethylamino)-1,2-oxazole-3-carbaldehyde is sourced from PubChem (CID 96632493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).