C7H6N2OS — CID 96633072
3-methylthieno[2,3-d]imidazole-2-carbaldehyde (PubChem CID 96633072) has the molecular formula C7H6N2OS and a molecular weight of 166.21 g/mol. Its IUPAC name is 3-methylthieno[2,3-d]imidazole-2-carbaldehyde.
| Compound Name | 3-methylthieno[2,3-d]imidazole-2-carbaldehyde |
|---|---|
| PubChem CID | 96633072 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 3-methylthieno[2,3-d]imidazole-2-carbaldehyde |
| SMILES | Cn1c(C=O)nc2ccsc21 |
| InChI | InChI=1S/C7H6N2OS/c1-9-6(4-10)8-5-2-3-11-7(5)9/h2-4H,1H3 |
| InChIKey | DSDRAEJXPLPLRT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|