C7H8N4O — CID 96633660
[3-(1,3-oxazol-5-yl)imidazol-4-yl]methanamine (PubChem CID 96633660) has the molecular formula C7H8N4O and a molecular weight of 164.17 g/mol. Its IUPAC name is [3-(1,3-oxazol-5-yl)imidazol-4-yl]methanamine.
| Compound Name | [3-(1,3-oxazol-5-yl)imidazol-4-yl]methanamine |
|---|---|
| PubChem CID | 96633660 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | [3-(1,3-oxazol-5-yl)imidazol-4-yl]methanamine |
| SMILES | NCc1cncn1-c1cnco1 |
| InChI | InChI=1S/C7H8N4O/c8-1-6-2-9-4-11(6)7-3-10-5-12-7/h2-5H,1,8H2 |
| InChIKey | HMSKGWGAAINOTQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |