About 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde
5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde (PubChem CID 96635869) has the molecular formula C6H4N2O3
and a molecular weight of 152.11 g/mol. Its IUPAC name is 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde |
| PubChem CID | 96635869 |
| Molecular Formula | C6H4N2O3 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde |
| SMILES | Nc1cc2oc(C=O)nc2o1 |
| InChI | InChI=1S/C6H4N2O3/c7-4-1-3-6(11-4)8-5(2-9)10-3/h1-2H,7H2 |
| InChIKey | IDROBSBEDNLVPE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde?
The IUPAC name of 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde (CID 96635869) is 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde.
What is the SMILES notation for 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde?
The canonical SMILES for 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde is Nc1cc2oc(C=O)nc2o1.
What is the InChIKey of 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde?
The InChIKey is IDROBSBEDNLVPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O3/c7-4-1-3-6(11-4)8-5(2-9)10-3/h1-2H,7H2.
What are the key properties of 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde?
5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde has a molecular weight of 152.11 g/mol, XLogP of 0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminofuro[2,3-d][1,3]oxazole-2-carbaldehyde is sourced from PubChem (CID 96635869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).