C5H8O3S — CID 96636309
(3R,4R)-4-hydroxythiolane-3-carboxylic acid (PubChem CID 96636309) has the molecular formula C5H8O3S and a molecular weight of 148.18 g/mol. Its IUPAC name is (3R,4R)-4-hydroxythiolane-3-carboxylic acid.
| Compound Name | (3R,4R)-4-hydroxythiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 96636309 |
| Molecular Formula | C5H8O3S |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.02 |
| IUPAC Name | (3R,4R)-4-hydroxythiolane-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSC[C@@H]1O |
| InChI | InChI=1S/C5H8O3S/c6-4-2-9-1-3(4)5(7)8/h3-4,6H,1-2H2,(H,7,8)/t3-,4+/m1/s1 |
| InChIKey | ZUFHLNMIGNATBE-DMTCNVIQSA-N |
| XLogP | -0.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |