About 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile
2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile (PubChem CID 96636335) has the molecular formula C7H4N2O2
and a molecular weight of 148.12 g/mol. Its IUPAC name is 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile.
Molecular Properties
| Compound Name | 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile |
| PubChem CID | 96636335 |
| Molecular Formula | C7H4N2O2 |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile |
| SMILES | Cc1nc2c(C#N)coc2o1 |
| InChI | InChI=1S/C7H4N2O2/c1-4-9-6-5(2-8)3-10-7(6)11-4/h3H,1H3 |
| InChIKey | FWYYBIJASANOAA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 62.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile?
The IUPAC name of 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile (CID 96636335) is 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile.
What is the SMILES notation for 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile?
The canonical SMILES for 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile is Cc1nc2c(C#N)coc2o1.
What is the InChIKey of 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile?
The InChIKey is FWYYBIJASANOAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O2/c1-4-9-6-5(2-8)3-10-7(6)11-4/h3H,1H3.
What are the key properties of 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile?
2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile has a molecular weight of 148.12 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylfuro[3,2-d][1,3]oxazole-6-carbonitrile is sourced from PubChem (CID 96636335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).