C8H16N2O — CID 96645682
(3R)-1,3-diethylpiperazin-2-one (PubChem CID 96645682) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is (3R)-1,3-diethylpiperazin-2-one.
| Compound Name | (3R)-1,3-diethylpiperazin-2-one |
|---|---|
| PubChem CID | 96645682 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (3R)-1,3-diethylpiperazin-2-one |
| SMILES | CC[C@H]1NCCN(CC)C1=O |
| InChI | InChI=1S/C8H16N2O/c1-3-7-8(11)10(4-2)6-5-9-7/h7,9H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | PAJMMWJDTTVBSJ-SSDOTTSWSA-N |
| XLogP | 0.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |