C12H14FNO4 — CID 96664419
(2S)-2-[[2-(5-fluoro-2-methoxyphenyl)acetyl]amino]propanoic acid (PubChem CID 96664419) has the molecular formula C12H14FNO4 and a molecular weight of 255.25 g/mol. Its IUPAC name is (2S)-2-[[2-(5-fluoro-2-methoxyphenyl)acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-(5-fluoro-2-methoxyphenyl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 96664419 |
| Molecular Formula | C12H14FNO4 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (2S)-2-[[2-(5-fluoro-2-methoxyphenyl)acetyl]amino]propanoic acid |
| SMILES | COc1ccc(F)cc1CC(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C12H14FNO4/c1-7(12(16)17)14-11(15)6-8-5-9(13)3-4-10(8)18-2/h3-5,7H,6H2,1-2H3,(H,14,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | XZVBDBWGAVVNPD-ZETCQYMHSA-N |
| XLogP | 0.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |