C14H18N4O — CID 96665204
4-[2-(5-cyclopropyl-1-methyl-1,2,4-triazol-3-yl)ethoxy]aniline (PubChem CID 96665204) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-[2-(5-cyclopropyl-1-methyl-1,2,4-triazol-3-yl)ethoxy]aniline.
| Compound Name | 4-[2-(5-cyclopropyl-1-methyl-1,2,4-triazol-3-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 96665204 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-[2-(5-cyclopropyl-1-methyl-1,2,4-triazol-3-yl)ethoxy]aniline |
| SMILES | Cn1nc(CCOc2ccc(N)cc2)nc1C1CC1 |
| InChI | InChI=1S/C14H18N4O/c1-18-14(10-2-3-10)16-13(17-18)8-9-19-12-6-4-11(15)5-7-12/h4-7,10H,2-3,8-9,15H2,1H3 |
| InChIKey | PUTLMINJIWKOFW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|