C13H17N3OS — CID 96666515
2-[2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)ethoxy]aniline (PubChem CID 96666515) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 2-[2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)ethoxy]aniline.
| Compound Name | 2-[2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 96666515 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-[2-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)ethoxy]aniline |
| SMILES | CC(C)c1nnc(CCOc2ccccc2N)s1 |
| InChI | InChI=1S/C13H17N3OS/c1-9(2)13-16-15-12(18-13)7-8-17-11-6-4-3-5-10(11)14/h3-6,9H,7-8,14H2,1-2H3 |
| InChIKey | LENKXLJQUPYWFR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|