C11H14N2O4S — CID 96667560
N-(2-hydroxyethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide (PubChem CID 96667560) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide.
| Compound Name | N-(2-hydroxyethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 96667560 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-(2-hydroxyethyl)-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
| SMILES | O=C1CCc2cc(S(=O)(=O)NCCO)ccc2N1 |
| InChI | InChI=1S/C11H14N2O4S/c14-6-5-12-18(16,17)9-2-3-10-8(7-9)1-4-11(15)13-10/h2-3,7,12,14H,1,4-6H2,(H,13,15) |
| InChIKey | QNPUGSCLQFHFNC-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |