C10H8Cl2N4O — CID 96667856
5-(3,5-dichloro-2-methoxyphenyl)-1,2,4-triazin-3-amine (PubChem CID 96667856) has the molecular formula C10H8Cl2N4O and a molecular weight of 271.11 g/mol. Its IUPAC name is 5-(3,5-dichloro-2-methoxyphenyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(3,5-dichloro-2-methoxyphenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 96667856 |
| Molecular Formula | C10H8Cl2N4O |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 5-(3,5-dichloro-2-methoxyphenyl)-1,2,4-triazin-3-amine |
| SMILES | COc1c(Cl)cc(Cl)cc1-c1cnnc(N)n1 |
| InChI | InChI=1S/C10H8Cl2N4O/c1-17-9-6(2-5(11)3-7(9)12)8-4-14-16-10(13)15-8/h2-4H,1H3,(H2,13,15,16) |
| InChIKey | HDQZUPIDVYFVEK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |