C13H12N4OS — CID 96668447
6-(5-amino-6-methylpyrimidin-4-yl)-4H-1,4-benzothiazin-3-one (PubChem CID 96668447) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is 6-(5-amino-6-methylpyrimidin-4-yl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(5-amino-6-methylpyrimidin-4-yl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 96668447 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 6-(5-amino-6-methylpyrimidin-4-yl)-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1ncnc(-c2ccc3c(c2)NC(=O)CS3)c1N |
| InChI | InChI=1S/C13H12N4OS/c1-7-12(14)13(16-6-15-7)8-2-3-10-9(4-8)17-11(18)5-19-10/h2-4,6H,5,14H2,1H3,(H,17,18) |
| InChIKey | YEWXONZNOIFVLR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |