C14H16N4S — CID 96668673
2-(2,3,5,6-tetramethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-amine (PubChem CID 96668673) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is 2-(2,3,5,6-tetramethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-amine.
| Compound Name | 2-(2,3,5,6-tetramethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-amine |
|---|---|
| PubChem CID | 96668673 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-(2,3,5,6-tetramethylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-amine |
| SMILES | Cc1cc(C)c(C)c(-c2nc3scc(N)n3n2)c1C |
| InChI | InChI=1S/C14H16N4S/c1-7-5-8(2)10(4)12(9(7)3)13-16-14-18(17-13)11(15)6-19-14/h5-6H,15H2,1-4H3 |
| InChIKey | LCDKMDSUCWDLTC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |