About methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate
methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate (PubChem CID 96675259) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate.
Molecular Properties
| Compound Name | methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate |
| PubChem CID | 96675259 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate |
| SMILES | COC(=O)CCCc1ccc2c(c1)nc(C)n2C |
| InChI | InChI=1S/C14H18N2O2/c1-10-15-12-9-11(5-4-6-14(17)18-3)7-8-13(12)16(10)2/h7-9H,4-6H2,1-3H3 |
| InChIKey | JPRLLEBZLLGBFN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate?
The IUPAC name of methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate (CID 96675259) is methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate.
What is the SMILES notation for methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate?
The canonical SMILES for methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate is COC(=O)CCCc1ccc2c(c1)nc(C)n2C.
What is the InChIKey of methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate?
The InChIKey is JPRLLEBZLLGBFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-10-15-12-9-11(5-4-6-14(17)18-3)7-8-13(12)16(10)2/h7-9H,4-6H2,1-3H3.
What are the key properties of methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate?
methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate has a molecular weight of 246.31 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,2-dimethylbenzimidazol-5-yl)butanoate is sourced from PubChem (CID 96675259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).