C16H22N2O2 — CID 96680162
4,7-dimethoxy-3-(piperidin-4-ylmethyl)-1H-indole (PubChem CID 96680162) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 4,7-dimethoxy-3-(piperidin-4-ylmethyl)-1H-indole.
| Compound Name | 4,7-dimethoxy-3-(piperidin-4-ylmethyl)-1H-indole |
|---|---|
| PubChem CID | 96680162 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4,7-dimethoxy-3-(piperidin-4-ylmethyl)-1H-indole |
| SMILES | COc1ccc(OC)c2c(CC3CCNCC3)c[nH]c12 |
| InChI | InChI=1S/C16H22N2O2/c1-19-13-3-4-14(20-2)16-15(13)12(10-18-16)9-11-5-7-17-8-6-11/h3-4,10-11,17-18H,5-9H2,1-2H3 |
| InChIKey | YXPSTLMROICYOY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |