About piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone
piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone (PubChem CID 96710202) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone.
Molecular Properties
| Compound Name | piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone |
| PubChem CID | 96710202 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone |
| SMILES | O=C(c1c(O)cc(O)cc1O)C1CCNCC1 |
| InChI | InChI=1S/C12H15NO4/c14-8-5-9(15)11(10(16)6-8)12(17)7-1-3-13-4-2-7/h5-7,13-16H,1-4H2 |
| InChIKey | UITCCGSKKDOROJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone?
The IUPAC name of piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone (CID 96710202) is piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone.
What is the SMILES notation for piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone?
The canonical SMILES for piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone is O=C(c1c(O)cc(O)cc1O)C1CCNCC1.
What is the InChIKey of piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone?
The InChIKey is UITCCGSKKDOROJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c14-8-5-9(15)11(10(16)6-8)12(17)7-1-3-13-4-2-7/h5-7,13-16H,1-4H2.
What are the key properties of piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone?
piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone has a molecular weight of 237.25 g/mol, XLogP of 0.99, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl-(2,4,6-trihydroxyphenyl)methanone is sourced from PubChem (CID 96710202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).