C11H23NO — CID 96710709
(2R)-2-[[(1S)-3,3-dimethylcyclohexyl]amino]propan-1-ol (PubChem CID 96710709) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is (2R)-2-[[(1S)-3,3-dimethylcyclohexyl]amino]propan-1-ol.
| Compound Name | (2R)-2-[[(1S)-3,3-dimethylcyclohexyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 96710709 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (2R)-2-[[(1S)-3,3-dimethylcyclohexyl]amino]propan-1-ol |
| SMILES | C[C@H](CO)N[C@H]1CCCC(C)(C)C1 |
| InChI | InChI=1S/C11H23NO/c1-9(8-13)12-10-5-4-6-11(2,3)7-10/h9-10,12-13H,4-8H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | REBUJBSVXILLOY-ZJUUUORDSA-N |
| XLogP | 1.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |