About 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone
2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone (PubChem CID 96735460) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone |
| PubChem CID | 96735460 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone |
| SMILES | CNCC(=O)c1ccns1 |
| InChI | InChI=1S/C6H8N2OS/c1-7-4-5(9)6-2-3-8-10-6/h2-3,7H,4H2,1H3 |
| InChIKey | NVWUJOZGRSXRRM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone?
The IUPAC name of 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone (CID 96735460) is 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone.
What is the SMILES notation for 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone?
The canonical SMILES for 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone is CNCC(=O)c1ccns1.
What is the InChIKey of 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone?
The InChIKey is NVWUJOZGRSXRRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c1-7-4-5(9)6-2-3-8-10-6/h2-3,7H,4H2,1H3.
What are the key properties of 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone?
2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone has a molecular weight of 156.21 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)-1-(1,2-thiazol-5-yl)ethanone is sourced from PubChem (CID 96735460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).