About (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one
(2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one (PubChem CID 96735463) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one.
Molecular Properties
| Compound Name | (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one |
| PubChem CID | 96735463 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one |
| SMILES | C[C@@H](N)C(=O)c1ccns1 |
| InChI | InChI=1S/C6H8N2OS/c1-4(7)6(9)5-2-3-8-10-5/h2-4H,7H2,1H3/t4-/m1/s1 |
| InChIKey | ZPSNBPHSRCUKLN-SCSAIBSYSA-N |
| XLogP | 0.67 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one?
The IUPAC name of (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one (CID 96735463) is (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one.
What is the SMILES notation for (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one?
The canonical SMILES for (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one is C[C@@H](N)C(=O)c1ccns1.
What is the InChIKey of (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one?
The InChIKey is ZPSNBPHSRCUKLN-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H8N2OS/c1-4(7)6(9)5-2-3-8-10-5/h2-4H,7H2,1H3/t4-/m1/s1.
What are the key properties of (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one?
(2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one has a molecular weight of 156.21 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-1-(1,2-thiazol-5-yl)propan-1-one is sourced from PubChem (CID 96735463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).