About (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid
(3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid (PubChem CID 96740689) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid.
Molecular Properties
| Compound Name | (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid |
| PubChem CID | 96740689 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid |
| SMILES | N[C@H](CC(=O)O)c1ccns1 |
| InChI | InChI=1S/C6H8N2O2S/c7-4(3-6(9)10)5-1-2-8-11-5/h1-2,4H,3,7H2,(H,9,10)/t4-/m1/s1 |
| InChIKey | LKMJIQPHAJQCAN-SCSAIBSYSA-N |
| XLogP | 0.62 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid?
The IUPAC name of (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid (CID 96740689) is (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid.
What is the SMILES notation for (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid?
The canonical SMILES for (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid is N[C@H](CC(=O)O)c1ccns1.
What is the InChIKey of (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid?
The InChIKey is LKMJIQPHAJQCAN-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c7-4(3-6(9)10)5-1-2-8-11-5/h1-2,4H,3,7H2,(H,9,10)/t4-/m1/s1.
What are the key properties of (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid?
(3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid has a molecular weight of 172.21 g/mol, XLogP of 0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-3-(1,2-thiazol-5-yl)propanoic acid is sourced from PubChem (CID 96740689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).