About 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine
1,4-dimethyl-2,3-dihydroquinoxalin-6-amine (PubChem CID 96742097) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine.
Molecular Properties
| Compound Name | 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine |
| PubChem CID | 96742097 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine |
| SMILES | CN1CCN(C)c2cc(N)ccc21 |
| InChI | InChI=1S/C10H15N3/c1-12-5-6-13(2)10-7-8(11)3-4-9(10)12/h3-4,7H,5-6,11H2,1-2H3 |
| InChIKey | HAZSHHQJIKQJSM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine?
The IUPAC name of 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine (CID 96742097) is 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine.
What is the SMILES notation for 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine?
The canonical SMILES for 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine is CN1CCN(C)c2cc(N)ccc21.
What is the InChIKey of 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine?
The InChIKey is HAZSHHQJIKQJSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-12-5-6-13(2)10-7-8(11)3-4-9(10)12/h3-4,7H,5-6,11H2,1-2H3.
What are the key properties of 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine?
1,4-dimethyl-2,3-dihydroquinoxalin-6-amine has a molecular weight of 177.25 g/mol, XLogP of 1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2,3-dihydroquinoxalin-6-amine is sourced from PubChem (CID 96742097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).