About (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine
(7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine (PubChem CID 96742266) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine.
Molecular Properties
| Compound Name | (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine |
| PubChem CID | 96742266 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine |
| SMILES | COc1nncc2cc(CN)[nH]c12 |
| InChI | InChI=1S/C8H10N4O/c1-13-8-7-5(4-10-12-8)2-6(3-9)11-7/h2,4,11H,3,9H2,1H3 |
| InChIKey | WPYIJJRYQZGDTL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine?
The IUPAC name of (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine (CID 96742266) is (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine.
What is the SMILES notation for (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine?
The canonical SMILES for (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine is COc1nncc2cc(CN)[nH]c12.
What is the InChIKey of (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine?
The InChIKey is WPYIJJRYQZGDTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c1-13-8-7-5(4-10-12-8)2-6(3-9)11-7/h2,4,11H,3,9H2,1H3.
What are the key properties of (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine?
(7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine has a molecular weight of 178.19 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methoxy-1H-pyrrolo[2,3-d]pyridazin-2-yl)methanamine is sourced from PubChem (CID 96742266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).