About 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one
9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one (PubChem CID 96743631) has the molecular formula C10H9FO2
and a molecular weight of 180.18 g/mol. Its IUPAC name is 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one.
Molecular Properties
| Compound Name | 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one |
| PubChem CID | 96743631 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one |
| SMILES | O=C1CCOc2c(F)cccc2C1 |
| InChI | InChI=1S/C10H9FO2/c11-9-3-1-2-7-6-8(12)4-5-13-10(7)9/h1-3H,4-6H2 |
| InChIKey | QODJXPIYHIHCAF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one?
The IUPAC name of 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one (CID 96743631) is 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one.
What is the SMILES notation for 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one?
The canonical SMILES for 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one is O=C1CCOc2c(F)cccc2C1.
What is the InChIKey of 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one?
The InChIKey is QODJXPIYHIHCAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO2/c11-9-3-1-2-7-6-8(12)4-5-13-10(7)9/h1-3H,4-6H2.
What are the key properties of 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one?
9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one has a molecular weight of 180.18 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-3,5-dihydro-2H-1-benzoxepin-4-one is sourced from PubChem (CID 96743631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).