About 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol
4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol (PubChem CID 96747484) has the molecular formula C9H12FNO2
and a molecular weight of 185.20 g/mol. Its IUPAC name is 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol.
Molecular Properties
| Compound Name | 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol |
| PubChem CID | 96747484 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol |
| SMILES | C[C@@H](N)[C@@H](O)c1ccc(O)cc1F |
| InChI | InChI=1S/C9H12FNO2/c1-5(11)9(13)7-3-2-6(12)4-8(7)10/h2-5,9,12-13H,11H2,1H3/t5-,9-/m1/s1 |
| InChIKey | NDGDUXJOTLXSEU-MLUIRONXSA-N |
| XLogP | 0.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol?
The IUPAC name of 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol (CID 96747484) is 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol.
What is the SMILES notation for 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol?
The canonical SMILES for 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol is C[C@@H](N)[C@@H](O)c1ccc(O)cc1F.
What is the InChIKey of 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol?
The InChIKey is NDGDUXJOTLXSEU-MLUIRONXSA-N. The full InChI is InChI=1S/C9H12FNO2/c1-5(11)9(13)7-3-2-6(12)4-8(7)10/h2-5,9,12-13H,11H2,1H3/t5-,9-/m1/s1.
What are the key properties of 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol?
4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol has a molecular weight of 185.20 g/mol, XLogP of 0.91, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,2R)-2-amino-1-hydroxypropyl]-3-fluorophenol is sourced from PubChem (CID 96747484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).