C12H17NO — CID 96751347
3,6-dimethyl-2-[(2S)-pyrrolidin-2-yl]phenol (PubChem CID 96751347) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 3,6-dimethyl-2-[(2S)-pyrrolidin-2-yl]phenol.
| Compound Name | 3,6-dimethyl-2-[(2S)-pyrrolidin-2-yl]phenol |
|---|---|
| PubChem CID | 96751347 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3,6-dimethyl-2-[(2S)-pyrrolidin-2-yl]phenol |
| SMILES | Cc1ccc(C)c([C@@H]2CCCN2)c1O |
| InChI | InChI=1S/C12H17NO/c1-8-5-6-9(2)12(14)11(8)10-4-3-7-13-10/h5-6,10,13-14H,3-4,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | JPPXMCLUKJIOAH-JTQLQIEISA-N |
| XLogP | 2.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|