About 2-(3,4-dimethoxythiophen-2-yl)acetic acid
2-(3,4-dimethoxythiophen-2-yl)acetic acid (PubChem CID 96761580) has the molecular formula C8H10O4S
and a molecular weight of 202.23 g/mol. Its IUPAC name is 2-(3,4-dimethoxythiophen-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxythiophen-2-yl)acetic acid |
| PubChem CID | 96761580 |
| Molecular Formula | C8H10O4S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 2-(3,4-dimethoxythiophen-2-yl)acetic acid |
| SMILES | COc1csc(CC(=O)O)c1OC |
| InChI | InChI=1S/C8H10O4S/c1-11-5-4-13-6(3-7(9)10)8(5)12-2/h4H,3H2,1-2H3,(H,9,10) |
| InChIKey | XFNQUJLCCPLQNG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dimethoxythiophen-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxythiophen-2-yl)acetic acid?
The IUPAC name of 2-(3,4-dimethoxythiophen-2-yl)acetic acid (CID 96761580) is 2-(3,4-dimethoxythiophen-2-yl)acetic acid.
What is the SMILES notation for 2-(3,4-dimethoxythiophen-2-yl)acetic acid?
The canonical SMILES for 2-(3,4-dimethoxythiophen-2-yl)acetic acid is COc1csc(CC(=O)O)c1OC.
What is the InChIKey of 2-(3,4-dimethoxythiophen-2-yl)acetic acid?
The InChIKey is XFNQUJLCCPLQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4S/c1-11-5-4-13-6(3-7(9)10)8(5)12-2/h4H,3H2,1-2H3,(H,9,10).
What are the key properties of 2-(3,4-dimethoxythiophen-2-yl)acetic acid?
2-(3,4-dimethoxythiophen-2-yl)acetic acid has a molecular weight of 202.23 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxythiophen-2-yl)acetic acid is sourced from PubChem (CID 96761580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).