C10H12F3N — CID 96762163
(1R)-1-[4-(2,2,2-trifluoroethyl)phenyl]ethanamine (PubChem CID 96762163) has the molecular formula C10H12F3N and a molecular weight of 203.21 g/mol. Its IUPAC name is (1R)-1-[4-(2,2,2-trifluoroethyl)phenyl]ethanamine.
| Compound Name | (1R)-1-[4-(2,2,2-trifluoroethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 96762163 |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (1R)-1-[4-(2,2,2-trifluoroethyl)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(CC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H12F3N/c1-7(14)9-4-2-8(3-5-9)6-10(11,12)13/h2-5,7H,6,14H2,1H3/t7-/m1/s1 |
| InChIKey | GPXYMXRSCUOXBH-SSDOTTSWSA-N |
| XLogP | 2.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |