About 2-(2,5-dimethylphenyl)acetohydrazide
2-(2,5-dimethylphenyl)acetohydrazide (PubChem CID 967809) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)acetohydrazide.
Molecular Properties
| Compound Name | 2-(2,5-dimethylphenyl)acetohydrazide |
| PubChem CID | 967809 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-(2,5-dimethylphenyl)acetohydrazide |
| SMILES | Cc1ccc(C)c(CC(=O)NN)c1 |
| InChI | InChI=1S/C10H14N2O/c1-7-3-4-8(2)9(5-7)6-10(13)12-11/h3-5H,6,11H2,1-2H3,(H,12,13) |
| InChIKey | BATNUXSXROWIMN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethylphenyl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylphenyl)acetohydrazide?
The IUPAC name of 2-(2,5-dimethylphenyl)acetohydrazide (CID 967809) is 2-(2,5-dimethylphenyl)acetohydrazide.
What is the SMILES notation for 2-(2,5-dimethylphenyl)acetohydrazide?
The canonical SMILES for 2-(2,5-dimethylphenyl)acetohydrazide is Cc1ccc(C)c(CC(=O)NN)c1.
What is the InChIKey of 2-(2,5-dimethylphenyl)acetohydrazide?
The InChIKey is BATNUXSXROWIMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-7-3-4-8(2)9(5-7)6-10(13)12-11/h3-5H,6,11H2,1-2H3,(H,12,13).
What are the key properties of 2-(2,5-dimethylphenyl)acetohydrazide?
2-(2,5-dimethylphenyl)acetohydrazide has a molecular weight of 178.23 g/mol, XLogP of 0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylphenyl)acetohydrazide is sourced from PubChem (CID 967809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).