About (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol
(2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol (PubChem CID 96784232) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol.
Molecular Properties
| Compound Name | (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol |
| PubChem CID | 96784232 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol |
| SMILES | C[C@@H]1CC(NCC[C@@H](C)O)C[C@@H](C)C1 |
| InChI | InChI=1S/C12H25NO/c1-9-6-10(2)8-12(7-9)13-5-4-11(3)14/h9-14H,4-8H2,1-3H3/t9-,10-,11+/m0/s1 |
| InChIKey | VCRMJIHTRUEYKE-GARJFASQSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol?
The IUPAC name of (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol (CID 96784232) is (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol.
What is the SMILES notation for (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol?
The canonical SMILES for (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol is C[C@@H]1CC(NCC[C@@H](C)O)C[C@@H](C)C1.
What is the InChIKey of (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol?
The InChIKey is VCRMJIHTRUEYKE-GARJFASQSA-N. The full InChI is InChI=1S/C12H25NO/c1-9-6-10(2)8-12(7-9)13-5-4-11(3)14/h9-14H,4-8H2,1-3H3/t9-,10-,11+/m0/s1.
What are the key properties of (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol?
(2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol has a molecular weight of 199.34 g/mol, XLogP of 2.17, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-[[(3S,5S)-3,5-dimethylcyclohexyl]amino]butan-2-ol is sourced from PubChem (CID 96784232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).