C10H13N3O3 — CID 96795164
(3R,4R)-4-(1,5-dimethylpyrazol-3-yl)-2-oxopyrrolidine-3-carboxylic acid (PubChem CID 96795164) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is (3R,4R)-4-(1,5-dimethylpyrazol-3-yl)-2-oxopyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-(1,5-dimethylpyrazol-3-yl)-2-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 96795164 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (3R,4R)-4-(1,5-dimethylpyrazol-3-yl)-2-oxopyrrolidine-3-carboxylic acid |
| SMILES | Cc1cc([C@H]2CNC(=O)[C@@H]2C(=O)O)nn1C |
| InChI | InChI=1S/C10H13N3O3/c1-5-3-7(12-13(5)2)6-4-11-9(14)8(6)10(15)16/h3,6,8H,4H2,1-2H3,(H,11,14)(H,15,16)/t6-,8-/m1/s1 |
| InChIKey | CTNURUAGEQWZPD-HTRCEHHLSA-N |
| XLogP | -0.36 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|