C14H16N4O4 — CID 96817755
3-[(1R)-1-methoxyethyl]-5-[(5-nitro-2,3-dihydroindol-1-yl)methyl]-1,2,4-oxadiazole (PubChem CID 96817755) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 3-[(1R)-1-methoxyethyl]-5-[(5-nitro-2,3-dihydroindol-1-yl)methyl]-1,2,4-oxadiazole.
| Compound Name | 3-[(1R)-1-methoxyethyl]-5-[(5-nitro-2,3-dihydroindol-1-yl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 96817755 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-[(1R)-1-methoxyethyl]-5-[(5-nitro-2,3-dihydroindol-1-yl)methyl]-1,2,4-oxadiazole |
| SMILES | CO[C@H](C)c1noc(CN2CCc3cc([N+](=O)[O-])ccc32)n1 |
| InChI | InChI=1S/C14H16N4O4/c1-9(21-2)14-15-13(22-16-14)8-17-6-5-10-7-11(18(19)20)3-4-12(10)17/h3-4,7,9H,5-6,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | CEWFOYIZBPNTNZ-SECBINFHSA-N |
| XLogP | 2.25 |
| TPSA | 94.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|