About N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide
N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide (PubChem CID 96824693) has the molecular formula C13H14N2O4S3
and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide.
Molecular Properties
| Compound Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide |
| PubChem CID | 96824693 |
| Molecular Formula | C13H14N2O4S3 |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide |
| SMILES | Cc1nc(C)c(S(=O)(=O)NC(=O)c2ccc([S@](C)=O)cc2)s1 |
| InChI | InChI=1S/C13H14N2O4S3/c1-8-13(20-9(2)14-8)22(18,19)15-12(16)10-4-6-11(7-5-10)21(3)17/h4-7H,1-3H3,(H,15,16)/t21-/m0/s1 |
| InChIKey | HORNEOHMACVMHL-NRFANRHFSA-N |
| XLogP | 1.62 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide?
The IUPAC name of N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide (CID 96824693) is N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide.
What is the SMILES notation for N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide?
The canonical SMILES for N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide is Cc1nc(C)c(S(=O)(=O)NC(=O)c2ccc([S@](C)=O)cc2)s1.
What is the InChIKey of N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide?
The InChIKey is HORNEOHMACVMHL-NRFANRHFSA-N. The full InChI is InChI=1S/C13H14N2O4S3/c1-8-13(20-9(2)14-8)22(18,19)15-12(16)10-4-6-11(7-5-10)21(3)17/h4-7H,1-3H3,(H,15,16)/t21-/m0/s1.
What are the key properties of N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide?
N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide has a molecular weight of 358.47 g/mol, XLogP of 1.62, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl]-4-[(S)-methylsulfinyl]benzamide is sourced from PubChem (CID 96824693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).