C13H15N3O5S — CID 96831190
(3R)-3-methyl-4-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 96831190) has the molecular formula C13H15N3O5S and a molecular weight of 325.35 g/mol. Its IUPAC name is (3R)-3-methyl-4-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | (3R)-3-methyl-4-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 96831190 |
| Molecular Formula | C13H15N3O5S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (3R)-3-methyl-4-[(5-nitro-1,3-benzoxazol-2-yl)methyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | C[C@@H]1CS(=O)(=O)CCN1Cc1nc2cc([N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C13H15N3O5S/c1-9-8-22(19,20)5-4-15(9)7-13-14-11-6-10(16(17)18)2-3-12(11)21-13/h2-3,6,9H,4-5,7-8H2,1H3/t9-/m1/s1 |
| InChIKey | HVLLYKNFGNCQMO-SECBINFHSA-N |
| XLogP | 1.35 |
| TPSA | 106.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|