About 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea
1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea (PubChem CID 96835180) has the molecular formula C18H24N4O3
and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea.
Molecular Properties
| Compound Name | 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea |
| PubChem CID | 96835180 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea |
| SMILES | C[C@@H](NC(=O)NCc1ccon1)[C@@H]1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C18H24N4O3/c1-14(20-18(23)19-11-16-7-9-25-21-16)17-13-22(8-10-24-17)12-15-5-3-2-4-6-15/h2-7,9,14,17H,8,10-13H2,1H3,(H2,19,20,23)/t14-,17+/m1/s1 |
| InChIKey | ABOBIZVFTWRAKM-PBHICJAKSA-N |
| XLogP | 1.76 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea?
The IUPAC name of 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea (CID 96835180) is 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea.
What is the SMILES notation for 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea?
The canonical SMILES for 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea is C[C@@H](NC(=O)NCc1ccon1)[C@@H]1CN(Cc2ccccc2)CCO1.
What is the InChIKey of 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea?
The InChIKey is ABOBIZVFTWRAKM-PBHICJAKSA-N. The full InChI is InChI=1S/C18H24N4O3/c1-14(20-18(23)19-11-16-7-9-25-21-16)17-13-22(8-10-24-17)12-15-5-3-2-4-6-15/h2-7,9,14,17H,8,10-13H2,1H3,(H2,19,20,23)/t14-,17+/m1/s1.
What are the key properties of 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea?
1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea has a molecular weight of 344.42 g/mol, XLogP of 1.76, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]ethyl]-3-(1,2-oxazol-3-ylmethyl)urea is sourced from PubChem (CID 96835180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).