C19H14Br2O4 — CID 96843329
(3E)-3-[(3,5-dibromo-4-methoxyphenyl)methylidene]-5-(4-methoxyphenyl)furan-2-one (PubChem CID 96843329) has the molecular formula C19H14Br2O4 and a molecular weight of 466.13 g/mol. Its IUPAC name is (3E)-3-[(3,5-dibromo-4-methoxyphenyl)methylidene]-5-(4-methoxyphenyl)furan-2-one.
| Compound Name | (3E)-3-[(3,5-dibromo-4-methoxyphenyl)methylidene]-5-(4-methoxyphenyl)furan-2-one |
|---|---|
| PubChem CID | 96843329 |
| Molecular Formula | C19H14Br2O4 |
| Molecular Weight | 466.13 g/mol |
| Exact Mass | 463.93 |
| IUPAC Name | (3E)-3-[(3,5-dibromo-4-methoxyphenyl)methylidene]-5-(4-methoxyphenyl)furan-2-one |
| SMILES | COc1ccc(C2=C/C(=C\c3cc(Br)c(OC)c(Br)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C19H14Br2O4/c1-23-14-5-3-12(4-6-14)17-10-13(19(22)25-17)7-11-8-15(20)18(24-2)16(21)9-11/h3-10H,1-2H3/b13-7+ |
| InChIKey | JMWILJOFINNJGL-NTUHNPAUSA-N |
| XLogP | 5.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.13 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|