C10H19NO3 — CID 96845258
tert-butyl (2S,4S)-4-hydroxypiperidine-2-carboxylate (PubChem CID 96845258) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-hydroxypiperidine-2-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-hydroxypiperidine-2-carboxylate |
|---|---|
| PubChem CID | 96845258 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | tert-butyl (2S,4S)-4-hydroxypiperidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H](O)CCN1 |
| InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)8-6-7(12)4-5-11-8/h7-8,11-12H,4-6H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | IIAIUFFONBIUMS-YUMQZZPRSA-N |
| XLogP | 0.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |