About (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid
(2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid (PubChem CID 96849104) has the molecular formula C5H7N3O3
and a molecular weight of 157.13 g/mol. Its IUPAC name is (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid |
| PubChem CID | 96849104 |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid |
| SMILES | N[C@@H](Cc1ncon1)C(=O)O |
| InChI | InChI=1S/C5H7N3O3/c6-3(5(9)10)1-4-7-2-11-8-4/h2-3H,1,6H2,(H,9,10)/t3-/m0/s1 |
| InChIKey | AJJVTENVLDKYQM-VKHMYHEASA-N |
| XLogP | -0.98 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid?
The IUPAC name of (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid (CID 96849104) is (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid.
What is the SMILES notation for (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid?
The canonical SMILES for (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid is N[C@@H](Cc1ncon1)C(=O)O.
What is the InChIKey of (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid?
The InChIKey is AJJVTENVLDKYQM-VKHMYHEASA-N. The full InChI is InChI=1S/C5H7N3O3/c6-3(5(9)10)1-4-7-2-11-8-4/h2-3H,1,6H2,(H,9,10)/t3-/m0/s1.
What are the key properties of (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid?
(2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid has a molecular weight of 157.13 g/mol, XLogP of -0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(1,2,4-oxadiazol-3-yl)propanoic acid is sourced from PubChem (CID 96849104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).