C9H15NOS — CID 96854417
(1S)-3-amino-1-(3-ethylthiophen-2-yl)propan-1-ol (PubChem CID 96854417) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is (1S)-3-amino-1-(3-ethylthiophen-2-yl)propan-1-ol.
| Compound Name | (1S)-3-amino-1-(3-ethylthiophen-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 96854417 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | (1S)-3-amino-1-(3-ethylthiophen-2-yl)propan-1-ol |
| SMILES | CCc1ccsc1[C@@H](O)CCN |
| InChI | InChI=1S/C9H15NOS/c1-2-7-4-6-12-9(7)8(11)3-5-10/h4,6,8,11H,2-3,5,10H2,1H3/t8-/m0/s1 |
| InChIKey | RRTYLMOCQVHARD-QMMMGPOBSA-N |
| XLogP | 1.69 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |