About (Z)-pent-2-enimidamide
(Z)-pent-2-enimidamide (PubChem CID 96869220) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is (Z)-pent-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-pent-2-enimidamide |
| PubChem CID | 96869220 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | (Z)-pent-2-enimidamide |
| SMILES | [H]/N=C(N)/C=C\CC |
| InChI | InChI=1S/C5H10N2/c1-2-3-4-5(6)7/h3-4H,2H2,1H3,(H3,6,7)/b4-3- |
| InChIKey | CGGYDSAUSCXDTN-ARJAWSKDSA-N |
| XLogP | 0.89 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-pent-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-pent-2-enimidamide?
The IUPAC name of (Z)-pent-2-enimidamide (CID 96869220) is (Z)-pent-2-enimidamide.
What is the SMILES notation for (Z)-pent-2-enimidamide?
The canonical SMILES for (Z)-pent-2-enimidamide is [H]/N=C(N)/C=C\CC.
What is the InChIKey of (Z)-pent-2-enimidamide?
The InChIKey is CGGYDSAUSCXDTN-ARJAWSKDSA-N. The full InChI is InChI=1S/C5H10N2/c1-2-3-4-5(6)7/h3-4H,2H2,1H3,(H3,6,7)/b4-3-.
What are the key properties of (Z)-pent-2-enimidamide?
(Z)-pent-2-enimidamide has a molecular weight of 98.15 g/mol, XLogP of 0.89, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-pent-2-enimidamide is sourced from PubChem (CID 96869220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).